1-benzylazepan-4-amine hydrochloride

1-benzylazepan-4-amine hydrochloride

tert-butyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate

tert-butyl (2R)-2-methyl-3-oxopiperazine-1-carboxylate

1-[(tert-butoxy)carbonyl]-4-oxopyrrolidine-2-carboxylic acid

$200.00
CAS No.: 876317-19-0
Catalog No.: 160309
Purity: 95%
MF: C10H15NO5
MW: 229.232
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)N1CC(=O)CC1C(O)=O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
160309
  • Size
    Price
    Stock
    Estimated Shipping Time
1-[(tert-butoxy)carbonyl]-4-oxopyrrolidine-2-carboxylic acid; CAS No.: 876317-19-0; 1-[(tert-butoxy)carbonyl]-4-oxopyrrolidine-2-carboxylic acid is a blocks chemistry example that demonstrates ChemShuttle's ability to supply specialized chemical entities for research purposes. As a blocks chemistry compound with unique reactivity, this substance illustrates the company's focus on providing essential building blocks for chemical synthesis. The blocks chemistry offerings from ChemShuttle, including 1-[(tert-butoxy)carbonyl]-4-oxopyrrolidine-2-carboxylic acid (CAS No.: 876317-19-0), are crucial for the development of new pharmaceuticals. These blocks chemistry compounds serve as the foundation for numerous custom synthesis projects, enabling researchers to construct complex molecules with potential therapeutic applications. By supplying a diverse array of blocks chemistry compounds, ChemShuttle supports the innovative efforts of scientists in the pharmaceutical industry. The 1-[(tert-butoxy)carbonyl]-4-oxopyrrolidine-2-carboxylic acid (CAS No.: 876317-19-0) exemplifies the company's dedication to offering high-quality building blocks that facilitate advances in chemical research.

Reviews

Write Your Own Review
You're reviewing:1-[(tert-butoxy)carbonyl]-4-oxopyrrolidine-2-carboxylic acid
Your Rating