1-(4-chloro-2-methoxyphenyl)piperazine hydrochloride
$345.00
CAS No.: 89988-99-8
Catalog No.: 103559
Purity: 95%
MF: C11H16Cl2N2O
MW: 263.168
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC1=CC(Cl)=CC=C1N1CCNCC1
Catalog No.: 103559
Purity: 95%
MF: C11H16Cl2N2O
MW: 263.168
Storage: 2-8 degree Celsius
SMILES: Cl[H].COC1=CC(Cl)=CC=C1N1CCNCC1
For R&D use only. Not for human or veterinary use.
1-(4-chloro-2-methoxyphenyl)piperazine hydrochloride,CAS No.: 89988-99-8 - This chemical is a crucial component in the synthesis of bioactive molecules, particularly in the field of immunology. Its downstream uses include the development of vaccines and immunotherapies. The compound's ability to induce specific immune responses is a major advantage, making it valuable in therapeutic applications.
Reviews
Write Your Own Review