1-bromo-3-fluoro-5-(trifluoromethoxy)benzene
$300.00
CAS No.: 1129541-09-8
Catalog No.: 193839
Purity: 95%
MF: C7H3BrF4O
MW: 258.996
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=CC(=C1)OC(F)(F)F)F
Catalog No.: 193839
Purity: 95%
MF: C7H3BrF4O
MW: 258.996
Storage: 2-8 degree Celsius
SMILES: BrC1=CC(=CC(=C1)OC(F)(F)F)F
1-bromo-3-fluoro-5-(trifluoromethoxy)benzene; CAS No.: 1129541-09-8;1-bromo-3-fluoro-5-(trifluoromethoxy)benzene. PROPERTIES: 1-bromo-3-fluoro-5-(trifluoromethoxy)benzene is a brominated and fluorinated aromatic compound with molecular formula C6H3BrF3O. It typically exists as a colorless liquid with a mild aromatic odor, having a boiling point around 100-105 C. The compound has limited water solubility but dissolves well in organic solvents like chloroform or diethyl ether. It exhibits moderate thermal stability but may decompose when exposed to high temperatures or strong bases, releasing toxic halogen-containing fumes. Proper storage involves keeping it in tightly sealed containers below 25 C, away from heat sources and incompatible materials. APPLICATIONS: In organic synthesis, this compound serves as a building block for creating highly functionalized aromatic systems. The bromo substituent enables cross-coupling reactions to form biaryl structures, while the fluoro and trifluoromethoxy groups provide strong electron-withdrawing effects that influence reactivity and selectivity (Tetrahedron Letters). In pharmaceutical development, 1-bromo-3-fluoro-5-(trifluoromethoxy)benzene contributes to the synthesis of antimicrobial and anticancer agents where the halogenated aromatic scaffold enhances binding to biological targets (European Journal of Medicinal Chemistry). The compound also finds application in materials science as a precursor for creating organic semiconductors with tailored electronic properties, where the electron-deficient aromatic core influences charge transport characteristics (Journal of Materials Chemistry C).
Reviews
Write Your Own Review