methyl 4-hydroxy-2-(trifluoromethyl)benzoate

methyl 4-hydroxy-2-(trifluoromethyl)benzoate

methyl 4-cyano-2-(trifluoromethyl)benzoate

methyl 4-cyano-2-(trifluoromethyl)benzoate

methyl 4-fluoro-3-methoxyphenylacetate

$300.00
CAS No.: 1427397-59-8
Catalog No.: 194155
Purity: 95%
MF: C10H11FO3
MW: 198.193
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=C(C=C1)CC(=O)OC)OC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194155
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4-fluoro-3-methoxyphenylacetate; CAS No.: 1427397-59-8; methyl 4-fluoro-3-methoxyphenylacetate. PROPERTIES: methyl 4-fluoro-3-methoxyphenylacetate is a crystalline solid. Its molecular formula is C11H11FNO3, and the molecular weight is approximately 218.21 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a fluorine atom and a methoxy group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4-fluoro-3-methoxyphenylacetate serves as a versatile intermediate. The fluorine atom influences the electronic properties of the aromatic ring, the methoxy group can be converted to other functional groups such as hydroxyl or halide, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of methyl 4-fluoro-3-methoxyphenylacetate can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4-fluoro-3-methoxyphenylacetate
Your Rating