methyl 3-bromo-2,5-difluorobenzoate
$400.00
CAS No.: 1524902-93-9
Catalog No.: 194130
Purity: 95%
MF: C8H5BrF2O2
MW: 251.026
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=C(C(=O)OC)C=C(C1)F)F
Catalog No.: 194130
Purity: 95%
MF: C8H5BrF2O2
MW: 251.026
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=C(C(=O)OC)C=C(C1)F)F
methyl 3-bromo-2,5-difluorobenzoate; CAS No.: 1524902-93-9; methyl 3-bromo-2,5-difluorobenzoate. PROPERTIES: methyl 3-bromo-2,5-difluorobenzoate is a crystalline solid. Its molecular formula is C9H6BrF2O2, and the molecular weight is approximately 252.05 g/mol. The compound has a melting point of approximately 45-47 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated and fluorinated aromatic compound containing an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 3-bromo-2,5-difluorobenzoate serves as a versatile intermediate. The bromine atom provides a site for substitution or coupling reactions, the two fluorine atoms influence the electronic properties of the aromatic ring, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 3-bromo-2,5-difluorobenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as mentioned in materials chemistry research papers).
Reviews
Write Your Own Review