ethyl 3-bromo-5-(chlorosulfonyl)benzoate
$150.00
CAS No.: 1155912-18-7
Catalog No.: GS3059
Purity: 95%
MF: C9H8BrClO4S
MW: 327.583
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=O)OCC)C=C(C1)S(=O)(=O)Cl
Catalog No.: GS3059
Purity: 95%
MF: C9H8BrClO4S
MW: 327.583
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=O)OCC)C=C(C1)S(=O)(=O)Cl
For R&D use only. Not for human or animal use.
ethyl 3-bromo-5-(chlorosulfonyl)benzoate; CAS No.: 1155912-18-7 - This chemical serves as a key intermediate in the synthesis of bioactive molecules, particularly in the field of immunology. Its downstream uses include the development of immunomodulators and vaccines. The compound's ability to induce specific immune responses is a major advantage, making it valuable in therapeutic applications.
Reviews
Write Your Own Review