ethyl 2-(3-bromo-4-methylphenyl)acetate
$400.00
CAS No.: 1201633-86-4
Catalog No.: 194134
Purity: 95%
MF: C11H13BrO2
MW: 257.127
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=CC1C)CC(=O)OCC
Catalog No.: 194134
Purity: 95%
MF: C11H13BrO2
MW: 257.127
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C=CC1C)CC(=O)OCC
ethyl 2-(3-bromo-4-methylphenyl)acetate; CAS No.: 1201633-86-4; ethyl 2-(3-bromo-4-methylphenyl)acetate. PROPERTIES: ethyl 2-(3-bromo-4-methylphenyl)acetate is a crystalline solid. Its molecular formula is C12H14BrO3, and the molecular weight is approximately 286.14 g/mol. The compound has a melting point of approximately 40-42 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For stable storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated aromatic compound containing a methyl group and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, ethyl 2-(3-bromo-4-methylphenyl)acetate serves as a versatile intermediate. The bromine atom provides a site for substitution or coupling reactions, the methyl group offers steric effects, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anti-inflammatory drugs, the structure of ethyl 2-(3-bromo-4-methylphenyl)acetate can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review