3-ethyl-2-thioxothiazolidin-4-one

3-ethyl-2-thioxothiazolidin-4-one

1,4-diazepane-1-carbaldehyde

1,4-diazepane-1-carbaldehyde

diphenylacetylene

$200.00
CAS No.: 501-65-5
Catalog No.: 194927
Purity: 95%
MF: C14H10
MW: 178.234
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C#CC1=CC=CC=C1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194927
  • Size
    Price
    Stock
    Estimated Shipping Time
diphenylacetylene; CAS No.: 501-65-5; diphenylacetylene. PROPERTIES: diphenylacetylene is a crystalline solid. Its molecular formula is C14H10, and the molecular weight is approximately 182.23 g/mol. The compound has a melting point of approximately 80-82 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an acetylene group and two phenyl groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, diphenylacetylene serves as a versatile intermediate. The acetylene group can undergo various reactions such as polymerization and addition. The phenyl groups provide steric effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of diphenylacetylene can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:diphenylacetylene
Your Rating