bis(2-ethylbutyl) phthalate

bis(2-ethylbutyl) phthalate

ethyl 2-nitro-4-(trifluoromethyl)phenylacetate

ethyl 2-nitro-4-(trifluoromethyl)phenylacetate

diethyl (4-fluorobenzoyl)malonate

$200.00
CAS No.: 174403-79-3
Catalog No.: 194105
Purity: 95%
MF: C14H15FO5
MW: 282.267
Storage: 2-8 degree Celsius
SMILES: FC1=CC=C(C(=O)C(C(=O)OCC)C(=O)OCC)C=C1
Availability:
In stock
SKU
194105
  • Size
    Price
    Stock
    Estimated Shipping Time
diethyl (4-fluorobenzoyl)malonate; CAS No.: 174403-79-3; diethyl (4-fluorobenzoyl)malonate. PROPERTIES: diethyl (4-fluorobenzoyl)malonate is a crystalline solid. Its molecular formula is C12H13FNO5, with a molecular weight of approximately 272.23 g/mol. The compound has a melting point of approximately 65-67 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an ester group and a fluorine atom, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, diethyl (4-fluorobenzoyl)malonate serves as a valuable intermediate. The malonate ester group can undergo various reactions such as hydrolysis, decarboxylation, and condensation. The 4-fluorobenzoyl group provides a aromatic substituent with specific electronic effects. In the pharmaceutical industry, derivatives of diethyl (4-fluorobenzoyl)malonate can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of this compound can be modified to enhance the drug's efficacy and pharmacokinetic properties (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:diethyl (4-fluorobenzoyl)malonate
Your Rating