![dibenzo[b,e]oxepin-11(6H)-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/w/l/wlz1828_1.jpg)
cyclopropyl-4-chlorophenyl ketone
$300.00
CAS No.: 6640-25-1
Catalog No.: WLZ1829
Purity: 95%
MF: C19H16Cl2O
MW: 331.242
Storage: 2-8 degree Celsius
SMILES: C1(CC1)C1=C(C=CC(=C1)Cl)C(=O)C1=C(C=C(C=C1)Cl)C1CC1
Catalog No.: WLZ1829
Purity: 95%
MF: C19H16Cl2O
MW: 331.242
Storage: 2-8 degree Celsius
SMILES: C1(CC1)C1=C(C=CC(=C1)Cl)C(=O)C1=C(C=C(C=C1)Cl)C1CC1
CAS NO.: 6640-25-1; cyclopropyl-4-chlorophenyl ketone. PROPERTIES: This ketone features a cyclopropyl group and a chlorine atom on a benzene ring, creating a molecule with potential applications in organic synthesis and pharmaceutical research. The cyclopropyl-4-chlorophenyl ketone typically appears as a colorless to pale yellow liquid with moderate solubility in common organic solvents. Its molecular structure includes a cyclopropyl group that influences the electronic and steric properties of the aromatic system. For optimal stability and to prevent premature reactions, this compound should be stored at 2-8 degree Celsius in an amber glass bottle under an inert atmosphere. When handling, appropriate safety measures including nitrile gloves and safety goggles are recommended. This compound is sensitive to light and moisture, requiring careful environmental control during storage and use. In case of skin contact, wash thoroughly with soap and water; if eye contact occurs, rinse immediately and seek medical evaluation. APPLICATIONS: The cyclopropyl-4-chlorophenyl ketone serves as a versatile building block in organic synthesis, particularly for creating cyclopropyl-substituted bioactive molecules. The ketone group provides a handle for further functionalization through reactions such as reduction or nucleophilic addition. In medicinal chemistry, this compound functions as an intermediate for developing pharmaceuticals targeting enzyme inhibitors and receptor modulators. The cyclopropyl and chlorine substituents contribute to target binding affinity and selectivity. Additionally, the molecule finds utility in materials science as a monomer for creating polymers with specific electronic and optical properties. Researchers utilizing this compound can benefit from its functional group versatility, enabling the development of diverse molecular architectures for applications ranging from drug discovery to advanced materials.
Reviews
Write Your Own Review