3,5-dichloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol
$100.00
CAS No.: 2557358-67-3
Catalog No.: 192505
Purity: 95%
MF: C12H15BCl2O3
MW: 288.967
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=C(C=C(C1)Cl)O)B1OC(C(O1)(C)C)(C)C
Catalog No.: 192505
Purity: 95%
MF: C12H15BCl2O3
MW: 288.967
Storage: 2-8 degree Celsius
SMILES: ClC=1C(=C(C=C(C1)Cl)O)B1OC(C(O1)(C)C)(C)C
3,5-dichloro-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenol; CAS No.: 2557358-67-3: This compound is a valuable building block in the synthesis of bioactive molecules, particularly in the field of infectious diseases. Its downstream uses include the development of antiviral and antibacterial agents, contributing to global health efforts.
Reviews
Write Your Own Review