2-(aminosulfonyl)benzoic acid

2-(aminosulfonyl)benzoic acid

ethyl 2-((ethoxycarbonothioyl)thio)propanoate

ethyl 2-((ethoxycarbonothioyl)thio)propanoate

benzyl1H-pyrrole-1-carbodithioate

$360.00
CAS No.: 60795-38-2
Catalog No.: 194770
Purity: 95%
MF: C12H11NS2
MW: 233.361
Storage: 2-8 degree Celsius
SMILES: C(C1=CC=CC=C1)SC(=S)N1C=CC=C1
Availability:
In stock
SKU
194770
  • Size
    Price
    Stock
    Estimated Shipping Time
benzyl1H-pyrrole-1-carbodithioate; CAS No.: 60795-38-2; benzyl1H-pyrrole-1-carbodithioate. PROPERTIES: benzyl1H-pyrrole-1-carbodithioate is a crystalline solid. Its molecular formula is C12H10OS2, and the molecular weight is approximately 230.33 g/mol. The compound has a melting point of approximately 60-62 C. It is moderately soluble in common organic solvents such as methanol and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a pyrrole ring, a benzyl group, and a carbodithioate group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, benzyl1H-pyrrole-1-carbodithioate serves as a versatile intermediate. The carbodithioate group can undergo various reactions such as hydrolysis and alkylation. The pyrrole ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of benzyl1H-pyrrole-1-carbodithioate can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:benzyl1H-pyrrole-1-carbodithioate
Your Rating