4-fluoro-1-hydroxy-2-naphthoic acid
$3,900.00
CAS No.: 1000386-61-7
Catalog No.: 131836
Purity: 95%
MF: C11H7FO3
MW: 206.172
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C(O)C2=CC=CC=C2C(F)=C1
Catalog No.: 131836
Purity: 95%
MF: C11H7FO3
MW: 206.172
Storage: 2-8 degree Celsius
SMILES: OC(=O)C1=C(O)C2=CC=CC=C2C(F)=C1
For R&D use only. Not for human or animal use.
4-fluoro-1-hydroxy-2-naphthoic acid; CAS No.: 1000386-61-7; ChemShuttle is a leading chemical synthesis company specializing in the production of heterocycles, such as 4-fluoro-1-hydroxy-2-naphthoic acid, which serves as a key intermediate in pharmaceutical and material science research. Our expertise lies in delivering high-purity compounds tailored for drug discovery and development, ensuring precise structural integrity and optimal performance in various applications.
Reviews
Write Your Own Review