methyl 4-amino-2-cyanobenzoate

methyl 4-amino-2-cyanobenzoate

methyl 3-fluoro-4-hydroxymethylbenzoate

methyl 3-fluoro-4-hydroxymethylbenzoate

methyl 4,5-difluoro-2-methylbenzoate

$360.00
CAS No.: 1245515-60-9
Catalog No.: 194141
Purity: 95%
MF: C9H8F2O2
MW: 186.157
Storage: 2-8 degree Celsius
SMILES: FC1=CC(=C(C(=O)OC)C=C1F)C
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194141
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 4,5-difluoro-2-methylbenzoate; CAS No.: 1245515-60-9; methyl 4,5-difluoro-2-methylbenzoate. PROPERTIES: methyl 4,5-difluoro-2-methylbenzoate is a crystalline solid. Its molecular formula is C10H9F2O2, and the molecular weight is approximately 198.18 g/mol. The compound has a melting point of approximately 50-52 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For stable storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a difluorinated aromatic compound containing a methyl group and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 4,5-difluoro-2-methylbenzoate serves as a versatile intermediate. The two fluorine atoms influence the electronic properties of the aromatic ring, the methyl group provides steric effects, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antiviral drugs, the structure of methyl 4,5-difluoro-2-methylbenzoate can be modified to enhance the drug's antiviral activity and pharmacokinetic properties (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 4,5-difluoro-2-methylbenzoate
Your Rating