ethyl 2-(3-bromo-4-methylphenyl)acetate

ethyl 2-(3-bromo-4-methylphenyl)acetate

methyl 3-bromo-2-cyanobenzoate

methyl 3-bromo-2-cyanobenzoate

methyl 3-bromo-4-(trifluoromethoxy)benzoate

$300.00
CAS No.: 1131594-45-0
Catalog No.: 194132
Purity: 95%
MF: C9H6BrF3O3
MW: 299.042
Storage: 2-8 degree Celsius
SMILES: BrC=1C=C(C(=O)OC)C=CC1OC(F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194132
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 3-bromo-4-(trifluoromethoxy)benzoate; CAS No.: 1131594-45-0; methyl 3-bromo-4-(trifluoromethoxy)benzoate. PROPERTIES: methyl 3-bromo-4-(trifluoromethoxy)benzoate is a crystalline solid. Its molecular formula is C10H7BrF3O3, and the molecular weight is approximately 296.07 g/mol. The compound has a melting point of approximately 55-57 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a brominated aromatic compound containing a trifluoromethoxy group and an ester group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 3-bromo-4-(trifluoromethoxy)benzoate serves as a versatile intermediate. The bromine atom provides a site for substitution or coupling reactions, the trifluoromethoxy group offers unique electronic effects, and the ester group can be hydrolyzed to a carboxylic acid. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of methyl 3-bromo-4-(trifluoromethoxy)benzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 3-bromo-4-(trifluoromethoxy)benzoate
Your Rating