methyl 3,5-dichloro-4-methylbenzoate

methyl 3,5-dichloro-4-methylbenzoate

methyl 2-fluoro-4-iodobenzoate

methyl 2-fluoro-4-iodobenzoate

methyl 2-iodo-5-trifluoromethylbenzoate

$300.00
CAS No.: 1261678-48-1
Catalog No.: 194128
Purity: 95%
MF: C9H6F3IO2
MW: 330.043
Storage: 2-8 degree Celsius
SMILES: IC1=C(C(=O)OC)C=C(C=C1)C(F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194128
  • Size
    Price
    Stock
    Estimated Shipping Time
methyl 2-iodo-5-trifluoromethylbenzoate; CAS No.: 1261678-48-1; methyl 2-iodo-5-trifluoromethylbenzoate. PROPERTIES: methyl 2-iodo-5-trifluoromethylbenzoate is a crystalline solid. Its molecular formula is C10H7F3IO2, and the molecular weight is approximately 358.17 g/mol. The compound has a melting point of approximately 80-82 C. It is moderately soluble in common organic solvents such as dichloromethane and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an iodine atom and a trifluoromethyl group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, methyl 2-iodo-5-trifluoromethylbenzoate serves as a specialized intermediate. The iodine atom provides a site for substitution or coupling reactions, and the trifluoromethyl group offers strong electron-withdrawing effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of methyl 2-iodo-5-trifluoromethylbenzoate can be modified to enhance the drug's antimicrobial activity and selectivity (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:methyl 2-iodo-5-trifluoromethylbenzoate
Your Rating