(S)-tert-butyl 6-(((9H-fluoren-9-yl)methoxy)carbonylamino)-2-aminohexanoate hydrochloride
$288.00
CAS No.: 330795-57-8
Catalog No.: 188359
Purity: 95%
MF: C25H33ClN2O4
MW: 461.002
Storage: 2-8 degree Celsius
SMILES: Cl.C1=CC=CC=2C3=CC=CC=C3C(C12)COC(=O)NCCCC[C@@H](C(=O)OC(C)(C)C)N
Catalog No.: 188359
Purity: 95%
MF: C25H33ClN2O4
MW: 461.002
Storage: 2-8 degree Celsius
SMILES: Cl.C1=CC=CC=2C3=CC=CC=C3C(C12)COC(=O)NCCCC[C@@H](C(=O)OC(C)(C)C)N
(S)-tert-butyl 6-(((9H-fluoren-9-yl)methoxy)carbonylamino)-2-aminohexanoate hydrochloride; CAS No.: 330795-57-8; (S)-tert-butyl 6-(((9H-fluoren-9-yl)methoxy)carbonylamino)-2-aminohexanoate hydrochloride is a chiral compound with multiple protected amino groups and a fluorenylmethoxy carbonyl protecting group. As a key intermediate in peptide synthesis and other pharmaceutical applications, it provides valuable starting material for constructing complex molecular frameworks. ChemShuttle's custom synthesis services excel in producing such intricate compounds through advanced chemical synthesis techniques. Our CRO chemical synthesis capabilities ensure that clients receive high-purity materials tailored to their specific research or development requirements. As a trusted chemical supplier, we support the pharmaceutical industry by providing access to essential building blocks that drive innovation in drug discovery and chemical research.
Reviews
Write Your Own Review