methyl 2-(4-bromo-3-fluorophenyl)acetate

methyl 2-(4-bromo-3-fluorophenyl)acetate

ethyl 4-bromo-3-methoxybenzoate

ethyl 4-bromo-3-methoxybenzoate

ethyl 5-amino-2-fluorobenzoate

$300.00
CAS No.: 123207-39-6
Catalog No.: 194110
Purity: 95%
MF: C9H10FNO2
MW: 183.182
Storage: 2-8 degree Celsius
SMILES: NC=1C=CC(=C(C(=O)OCC)C1)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194110
  • Size
    Price
    Stock
    Estimated Shipping Time
ethyl 5-amino-2-fluorobenzoate; CAS No.: 123207-39-6; ethyl 5-amino-2-fluorobenzoate. PROPERTIES: ethyl 5-amino-2-fluorobenzoate is a crystalline solid. Its molecular formula is C9H9FNO3, with a molecular weight of approximately 192.17 g/mol. The compound has a melting point of approximately 100-102 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an amino group and a fluorine atom, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, ethyl 5-amino-2-fluorobenzoate serves as a valuable intermediate. The amino group can undergo various reactions such as acylation, sulfonation, and diazotization. The fluorine atom provides unique electronic effects that can influence the reactivity of the aromatic ring. In the pharmaceutical industry, derivatives of ethyl 5-amino-2-fluorobenzoate can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the structure of this compound can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:ethyl 5-amino-2-fluorobenzoate
Your Rating