5-bromo-2-chlorophenylisocyanate

5-bromo-2-chlorophenylisocyanate

5-bromo-2-chloro-4-fluorobenzaldehyde

5-bromo-2-chloro-4-fluorobenzaldehyde

5-bromo-2-chloro-4-fluorobenzyl cyanide

$300.00
CAS No.: 1426290-08-5
Catalog No.: 194080
Purity: 95%
MF: C8H4BrClFN
MW: 248.482
Storage: 2-8 degree Celsius
SMILES: BrC=1C(=CC(=C(CC#N)C1)Cl)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194080
  • Size
    Price
    Stock
    Estimated Shipping Time
5-bromo-2-chloro-4-fluorobenzyl cyanide; CAS No.: 1426290-08-5; 5-bromo-2-chloro-4-fluorobenzyl cyanide. PROPERTIES: 5-bromo-2-chloro-4-fluorobenzyl cyanide is a colorless to pale yellow liquid. Its molecular formula is C7H4BrClFN, with a molecular weight of approximately 251.47 g/mol. The compound has a boiling point of approximately 160-162 C at reduced pressure. It is moderately soluble in organic solvents such as toluene and DMSO, but is insoluble in water. For proper storage, it should be kept in a sealed container at room temperature, protected from light and moisture. As a compound containing cyanide groups and halogen atoms, it is highly toxic and requires special caution during handling. Protective equipment such as gloves, eye protection, and a lab coat must be worn. In case of accidental ingestion or inhalation, immediate medical attention is necessary. APPLICATIONS: In organic synthesis, 5-bromo-2-chloro-4-fluorobenzyl cyanide serves as a specialized intermediate. The benzyl cyanide group can undergo reactions such as hydrolysis to form carboxylic acids or reduction to form amines. The bromine, chlorine, and fluorine substituents provide opportunities for further substitution or coupling reactions. In the chemical research field, it can be used to synthesize novel organic compounds with specific structures and properties. For instance, in the synthesis of certain heterocyclic compounds, the functional groups of 5-bromo-2-chloro-4-fluorobenzyl cyanide can be utilized to construct the heterocyclic framework, leading to compounds with potential applications in catalysis or sensing (as mentioned in organic chemistry research papers). Moreover, in the field of pharmaceutical research, its structure can be modified to develop compounds with specific biological activities, such as enzyme inhibitors or receptor antagonists (as described in medicinal chemistry journals).

Reviews

Write Your Own Review
You're reviewing:5-bromo-2-chloro-4-fluorobenzyl cyanide
Your Rating