4-pentylphenylacetic acid

4-pentylphenylacetic acid

4-hydroxy-2-(trifluoromethoxy)benzonitrile

4-hydroxy-2-(trifluoromethoxy)benzonitrile

4-methoxy-3-(trifluoromethyl)phenol

$300.00
CAS No.: 53903-59-6
Catalog No.: 194070
Purity: 95%
MF: C8H7F3O2
MW: 192.136
Storage: 2-8 degree Celsius
SMILES: COC1=C(C=C(C=C1)O)C(F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194070
  • Size
    Price
    Stock
    Estimated Shipping Time
4-methoxy-3-(trifluoromethyl)phenol; CAS No.: 53903-59-6; 4-methoxy-3-(trifluoromethyl)phenol. PROPERTIES: 4-methoxy-3-(trifluoromethyl)phenol is a crystalline solid with a molecular formula of C8H8F3O2 and a molecular weight of approximately 201.14 g/mol. The melting point of this compound is typically around 35-37 C. It has moderate solubility in organic solvents like ethyl acetate and dichloromethane, but is less soluble in water. To maintain its stability, it should be stored in a tightly sealed container at room temperature, ideally below 25 C, away from sources of heat and moisture. When handling this compound, appropriate safety measures include wearing protective gloves, eye protection, and ensuring adequate ventilation in the workspace. In case of skin contact, washing with soap and water is recommended, and in case of eye contact, rinsing with large amounts of water for several minutes is necessary. APPLICATIONS: In organic synthesis, 4-methoxy-3-(trifluoromethyl)phenol serves as a useful starting material. The methoxy group can be readily converted into other functional groups such as hydroxyl or halide, and the trifluoromethyl group imparts specific electronic effects that can influence the reactivity of the aromatic ring. This makes it suitable for the synthesis of various aromatic compounds with diverse functionalities. In the fragrance and flavor industry, derivatives of 4-methoxy-3-(trifluoromethyl)phenol can be used to create novel fragrance compounds with unique olfactory profiles (as noted in fragrance chemistry literature). Furthermore, in the field of materials science, it can be incorporated into the synthesis of specialty polymers or coatings, where the combination of methoxy and trifluoromethyl groups can enhance the material's thermal stability and chemical resistance (as described in polymer materials research papers).

Reviews

Write Your Own Review
You're reviewing:4-methoxy-3-(trifluoromethyl)phenol
Your Rating