4-fluoro-3-methylphenylacetic acid

4-fluoro-3-methylphenylacetic acid

4-ethyl-2-nitrophenol

4-ethyl-2-nitrophenol

4-fluoro-3-(trifluoromethoxy)benzoic acid

$200.00
CAS No.: 886496-49-7
Catalog No.: 194064
Purity: 95%
MF: C8H4F4O3
MW: 224.109
Storage: 2-8 degree Celsius
SMILES: FC1=C(C=C(C(=O)O)C=C1)OC(F)(F)F
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194064
  • Size
    Price
    Stock
    Estimated Shipping Time
4-fluoro-3-(trifluoromethoxy)benzoic acid; CAS No.: 886496-49-7; 4-fluoro-3-(trifluoromethoxy)benzoic acid. PROPERTIES: 4-fluoro-3-(trifluoromethoxy)benzoic acid is a crystalline solid with a molecular weight of 237.1 g/mol. It typically exhibits a melting point in the range of 115-118 C and limited water solubility, though it dissolves readily in organic solvents such as methanol, ethanol, and dichloromethane. The compound contains reactive functional groups including a carboxylic acid group, fluorine substituent, and trifluoromethoxy group, which contribute to its chemical versatility. For optimal storage, it should be kept in a tightly sealed container at temperatures below 20 C, preferably under inert atmosphere to prevent potential degradation. Safety considerations include wearing appropriate protective clothing, gloves, and eye/face protection to minimize exposure risk. The compound may cause eye irritation and skin irritation, and in case of accidental ingestion, immediate medical attention is advised. APPLICATIONS: 4-fluoro-3-(trifluoromethoxy)benzoic acid serves as a valuable intermediate in the synthesis of various pharmaceuticals, particularly in the development of anti-inflammatory and analgesic agents. Its unique substitution pattern allows for selective derivatization, making it suitable for constructing bioactive scaffolds, as reported in medicinal chemistry literature. In materials science, the compound functions as a building block for certain types of liquid crystalline materials and conductive polymers. The presence of the carboxylic acid group provides a convenient handle for further functionalization, enabling the formation of various derivatives such as esters, amides, and acid chlorides. Additionally, it is utilized in the preparation of specialty dyes and pigments, where its fluorinated architecture contributes to desired optical properties. The trifluoromethoxy group enhances the compound's ability to participate in specific interactions, expanding its utility in supramolecular chemistry applications. Through chemical modification of the carboxylic acid group, it can be converted into various functionalized derivatives, further expanding its application scope in organic synthesis.

Reviews

Write Your Own Review
You're reviewing:4-fluoro-3-(trifluoromethoxy)benzoic acid
Your Rating