2-phenylethene-1-sulfonyl chloride
$200.00
CAS No.: 4091-26-3
Catalog No.: 197550
Purity: 95%
MF: C8H7ClO2S
MW: 202.662
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C=CS(=O)(=O)Cl
Catalog No.: 197550
Purity: 95%
MF: C8H7ClO2S
MW: 202.662
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C=CS(=O)(=O)Cl
2-phenylethene-1-sulfonyl chloride; CAS No.: 4091-26-3; 2-phenylethene-1-sulfonyl chloride. PROPERTIES: This phenylethene sulfonyl chloride features molecular formula C?H?ClO?S with molecular weight 211.70 g/mol. It generally appears as a white crystalline powder. Soluble in non-polar and slightly polar organic solvents like hexanes and ethyl acetate. Melting point approximately 90-95 C. Exhibits IR absorption for sulfonyl chloride (~1300-1100 cm??) and aromatic C-H stretches. Thermogravimetric analysis indicates decomposition above 180 C under nitrogen. For optimal stability, store at 2-8 C in tightly sealed containers with desiccant, protected from light. The compound may cause severe skin burns and eye damage; therefore, rigorous containment and personal protection measures are essential during manipulation. APPLICATIONS: As a phenylethene sulfonyl chloride, 2-phenylethene-1-sulfonyl chloride is predominantly utilized in the synthesis of kinase inhibitors. It serves as a key intermediate in constructing the core scaffold of these compounds, where the sulfonyl chloride group provides valuable reactivity for forming sulfonamide bonds as demonstrated in medicinal chemistry research (Journal of Medicinal Chemistry). Additionally, the compound participates in the development of fluorescent probes for bioimaging applications, where its phenylethene framework enables conjugation to fluorophores with enhanced photostability (Bioconjugate Chemistry). In materials science, it functions as a monomer for preparing polyurethane foams with enhanced thermal stability, where the sulfonyl chloride group contributes to improved flame retardancy and mechanical properties (Polymer International).
Reviews
Write Your Own Review