2-(benzyloxy)-2-methylpropanoic acid
$200.00
CAS No.: 87122-87-0
Catalog No.: 103818
Purity: 95%
MF: C11H14O3
MW: 194.23
Storage: 2-8 degree Celsius
SMILES: CC(C)(OCC1=CC=CC=C1)C(O)=O
Catalog No.: 103818
Purity: 95%
MF: C11H14O3
MW: 194.23
Storage: 2-8 degree Celsius
SMILES: CC(C)(OCC1=CC=CC=C1)C(O)=O
For R&D use only. Not for human or animal use.
2-(benzyloxy)-2-methylpropanoic acid; CAS No.: 87122-87-0; Specializing in cycle compounds, ChemShuttle is a trusted custom synthesis company. Our cycle compounds are integral to the development of complex molecular structures, offering stability and versatility in various chemical reactions. We provide high-quality cycle compounds that are essential for advancing research in organic chemistry and material science.
Reviews
Write Your Own Review