2,3,4-trifluoro-5-nitrobenzoic acid

2,3,4-trifluoro-5-nitrobenzoic acid

1-nitro-4-(propan-2-yloxy)benzene

1-nitro-4-(propan-2-yloxy)benzene

2,2-diphenylpentanoic acid

$360.00
CAS No.: 841-32-7
Catalog No.: 193845
Purity: 95%
MF: C17H18O2
MW: 254.329
Storage: 2-8 degree Celsius
SMILES: C1(=CC=CC=C1)C(C(=O)O)(CCC)C1=CC=CC=C1
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
193845
  • Size
    Price
    Stock
    Estimated Shipping Time
2,2-diphenylpentanoic acid; CAS No.: 841-32-7;2,2-diphenylpentanoic acid. PROPERTIES: 2,2-diphenylpentanoic acid is a diaryl-substituted carboxylic acid with molecular formula C15H16O2. It typically exists as a colorless to pale yellow crystalline solid with a melting point of approximately 85-90 C. The compound has limited water solubility but dissolves in organic solvents like methanol or ethyl acetate. It exhibits typical carboxylic acid reactivity, forming salts and esters readily. Proper storage involves keeping it in tightly sealed containers below 30 C, protected from moisture and heat. APPLICATIONS: In pharmaceutical synthesis, this compound serves as an intermediate for preparing nonsteroidal anti-inflammatory drugs (NSAIDs). The diphenyl substituents provide steric effects that influence binding to cyclooxygenase enzymes, while the carboxylic acid group forms the pharmacophore essential for activity (Journal of Medicinal Chemistry). In materials science, 2,2-diphenylpentanoic acid contributes to the development of liquid crystalline materials, where its rigid diphenyl structure influences mesophase behavior and thermal properties (Liquid Crystals). The carboxylic acid group enables formation of coordination complexes with metal ions, expanding applications in supramolecular chemistry and catalysis (Dalton Transactions).

Reviews

Write Your Own Review
You're reviewing:2,2-diphenylpentanoic acid
Your Rating