4-methoxy-N-methylaniline hydrochloride

4-methoxy-N-methylaniline hydrochloride

3,4-bis(cyclopropylmethoxy)benzoic acid

3,4-bis(cyclopropylmethoxy)benzoic acid

1-(anthracen-9-yl)ethan-1-one

$450.00
CAS No.: 784-04-3
Catalog No.: 194198
Purity: 95%
MF: C16H12O
MW: 220.271
Storage: 2-8 degree Celsius
SMILES: C1=CC=CC2=CC3=CC=CC=C3C(=C12)C(C)=O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194198
  • Size
    Price
    Stock
    Estimated Shipping Time
1-(anthracen-9-yl)ethan-1-one; CAS No.: 784-04-3; 1-(anthracen-9-yl)ethan-1-one. PROPERTIES: 1-(anthracen-9-yl)ethan-1-one is a crystalline solid. Its molecular formula is C18H14O, and the molecular weight is approximately 250.31 g/mol. The compound has a melting point of approximately 90-92 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a ketone group and an anthracene ring, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 1-(anthracen-9-yl)ethan-1-one serves as a versatile intermediate. The ketone group can undergo various reactions such as nucleophilic addition, reduction, and condensation. The anthracene ring provides unique electronic and photophysical properties. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 1-(anthracen-9-yl)ethan-1-one can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as reported in medicinal chemistry journals). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as organic semiconductors or photovoltaic materials, where its structure can affect the material's electronic and optical properties (as noted in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:1-(anthracen-9-yl)ethan-1-one
Your Rating