1,3-dichloro-2-((4-((2-chloro-4-methoxyphenoxy)methyl)benzyl)oxy)benzene
$250.00
CAS No.: 146949-21-5
Catalog No.: ZB0039
Purity: 95%
MF: C21H17Cl3O3
MW: 423.723
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=CC=C1)Cl)OCC1=CC=C(C=C1)COC1=C(C=C(C=C1)OC)Cl
Catalog No.: ZB0039
Purity: 95%
MF: C21H17Cl3O3
MW: 423.723
Storage: 2-8 degree Celsius
SMILES: ClC1=C(C(=CC=C1)Cl)OCC1=CC=C(C=C1)COC1=C(C=C(C=C1)OC)Cl
1,3-dichloro-2-((4-((2-chloro-4-methoxyphenoxy)methyl)benzyl)oxy)benzene; CAS No.: 146949-21-5; 1,3-dichloro-2-((4-((2-chloro-4-methoxyphenoxy)methyl)benzyl)oxy)benzene highlights ChemShuttle's inclusion of multiply chlorinated aromatic ethers in their key intermediates selection. As a custom synthesis company offering CRO chemical synthesis, ChemShuttle produces these complex biaryl ethers essential for creating agrochemicals and pharmaceuticals with improved bioavailability. The methoxy substitution offers beneficial electronic effects that can influence receptor binding and selectivity. Their role as a worldwide chemical supplier ensures these compounds are available to research teams globally. ChemShuttle's expertise in producing halogenated aromatics ensures that researchers can obtain materials of sufficient quality for both early discovery and more advanced medicinal chemistry efforts.
Reviews
Write Your Own Review