2-(dimethylamino)-5-methoxybenzaldehyde

2-(dimethylamino)-5-methoxybenzaldehyde

2,4-diiodophenol

2,4-diiodophenol

1,2-naphthalenedicarbonitrile

$250.00
CAS No.: 19291-76-0
Catalog No.: 194956
Purity: 95%
MF: C12H6N2
MW: 178.194
Storage: 2-8 degree Celsius
SMILES: C=1(C(=CC=C2C=CC=CC12)C#N)C#N
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194956
  • Size
    Price
    Stock
    Estimated Shipping Time
1,2-naphthalenedicarbonitrile; CAS No.: 19291-76-0; 1,2-naphthalenedicarbonitrile. PROPERTIES: 1,2-naphthalenedicarbonitrile is a crystalline solid. Its molecular formula is C10H6N2, and the molecular weight is approximately 166.17 g/mol. The compound has a melting point of approximately 180-182 C. It is moderately soluble in common organic solvents such as methylene chloride and ethyl acetate, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a naphthalene ring and two cyano groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 1,2-naphthalenedicarbonitrile serves as a valuable intermediate. The cyano groups can be converted to other functional groups such as carboxylic acid or amine. The naphthalene ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain anticancer drugs, the structure of 1,2-naphthalenedicarbonitrile can be modified to enhance the drug's ability to target cancer cells and improve its therapeutic index (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:1,2-naphthalenedicarbonitrile
Your Rating