(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-azidopropanoic acid
$400.00
CAS No.: 684270-46-0
Catalog No.: 135883
Purity: 95%
MF: C18H16N4O4
MW: 352.35
Storage: 2-8 degree Celsius
SMILES: OC(=O)[C@H](CN=[N+]=[N-])NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2
Catalog No.: 135883
Purity: 95%
MF: C18H16N4O4
MW: 352.35
Storage: 2-8 degree Celsius
SMILES: OC(=O)[C@H](CN=[N+]=[N-])NC(=O)OCC1C2=CC=CC=C2C2=C1C=CC=C2
(S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-azidopropanoic acid; CAS No.: 684270-46-0; (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-azidopropanoic acid is classified as a chemical block, serving as a foundational component in the synthesis of complex organic molecules. As a chemical online store, ChemShuttle offers this compound to researchers and scientists seeking high-purity materials for their experiments. The company's custom synthesis services can produce CAS No.: 684270-46-0; (S)-2-((((9H-fluoren-9-yl)methoxy)carbonyl)amino)-3-azidopropanoic acid according to specific requirements, ensuring it meets the necessary standards for various applications. With a focus on building blocks for drug discovery, ChemShuttle recognizes the importance of this compound in advancing pharmaceutical research. As a leading chemicals distributor, ChemShuttle makes it easy for customers to access this vital chemical block, supporting innovation across multiple scientific disciplines. ChemShuttle's extensive library of chemical building blocks includes this compound, which plays a crucial role in the development of new pharmaceuticals and materials.
Reviews
Write Your Own Review