Zinc pivalate
$250.00
CAS No.: 15827-10-8
Catalog No.: 183203
Purity: 95%
MF: C10H18O4Zn
MW: 267.64
Storage: 2-8 degree Celsius
SMILES: [Zn++].CC(C)(C)C([O-])=O.CC(C)(C)C([O-])=O
Catalog No.: 183203
Purity: 95%
MF: C10H18O4Zn
MW: 267.64
Storage: 2-8 degree Celsius
SMILES: [Zn++].CC(C)(C)C([O-])=O.CC(C)(C)C([O-])=O
Zinc pivalate; CAS No.: 15827-10-8; Specializing in cycle compounds, ChemShuttle is a trusted custom synthesis company. Our cycle compounds are integral to the development of complex molecular structures, offering stability and versatility in various chemical reactions. We provide high-quality cycle compounds that are essential for advancing research in organic chemistry and material science.
Reviews
Write Your Own Review