2,2,4,6,6-pentamethyl-4-[(trimethylsilyl)oxy]-3,5-dioxa-2,4,6-trisilaheptane
$250.00
CAS No.: 17928-28-8
Catalog No.: 145322
Purity: 95%
MF: C10H30O3Si4
MW: 310.691
Storage: 2-8 degree Celsius
SMILES: C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C
Catalog No.: 145322
Purity: 95%
MF: C10H30O3Si4
MW: 310.691
Storage: 2-8 degree Celsius
SMILES: C[Si](C)(C)O[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C
2,2,4,6,6-pentamethyl-4-[(trimethylsilyl)oxy]-3,5-dioxa-2,4,6-trisilaheptane; CAS No.: 17928-28-8; 2,2,4,6,6-pentamethyl-4-[(trimethylsilyl)oxy]-3,5-dioxa-2,4,6-trisilaheptane (CAS 17928-28-8) exemplifies ChemShuttle s supply of various organic chemicals for silicone-based polymer research. This siloxane derivative (CAS 17928-28-8) is a various organic chemical used in coatings and adhesives. As a worldwide chemical supplier, ChemShuttle ensures consistent quality for CAS 17928-28-8, meeting industrial demand for various organic chemicals. The compound s thermal stability makes it a various organic chemical of choice for high-performance material engineering.
Reviews
Write Your Own Review