potassium trifluoro((2-(trimethylsilyl)ethoxy)methyl)borate
$180.00
CAS No.: 1027642-28-9
Catalog No.: ZB0228
Purity: 95%
MF: C6H15BF3KOSi
MW: 238.17
Storage: 2-8 degree Celsius
SMILES: C[Si](CCOC[B-](F)(F)F)(C)C.[K+]
Catalog No.: ZB0228
Purity: 95%
MF: C6H15BF3KOSi
MW: 238.17
Storage: 2-8 degree Celsius
SMILES: C[Si](CCOC[B-](F)(F)F)(C)C.[K+]
potassium trifluoro((2-(trimethylsilyl)ethoxy)methyl)borate; CAS No.: 1027642-28-9; ChemShuttle, a leading chemical synthesis company, supplies potassium trifluoro((2-(trimethylsilyl)ethoxy)methyl)borate as part of its pharma building blocks collection. This compound is a valuable intermediate in the synthesis of various medicinal products. Our custom synthesis services allow researchers to access specialized chemicals that meet their unique research needs. As a worldwide chemical supplier, we provide reliable access to essential building blocks, supporting scientific progress across multiple industries.
Reviews
Write Your Own Review