ethyl 2-(diethoxyphosphoryl)butanoate
$300.00
CAS No.: 17145-91-4
Catalog No.: 190152
Purity: 95%
MF: C10H21O5P
MW: 252.247
Storage: 2-8 degree Celsius
SMILES: C(C)OP(=O)(OCC)C(C(=O)OCC)CC
Catalog No.: 190152
Purity: 95%
MF: C10H21O5P
MW: 252.247
Storage: 2-8 degree Celsius
SMILES: C(C)OP(=O)(OCC)C(C(=O)OCC)CC
ethyl 2-(diethoxyphosphoryl)butanoate; CAS No.: 17145-91-4; ethyl 2-(diethoxyphosphoryl)butanoate is one of the many phosphorylated esters available through Chem Shuttle's extensive product offerings. As a leading chemicals distributor, Chem Shuttle offers access to ester derivatives with diethoxyphosphoryl substituents that are essential for the synthesis of various pharmaceuticals and agrochemicals. This compound, with its diethoxyphosphoryl group, serves as a valuable building block for the production of bioactive molecules with specific spatial configurations. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized chemicals to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity ethyl 2-(diethoxyphosphoryl)butanoate, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review