(2R,3S)-2-amino-3-methylpentanoic acid
$200.00
CAS No.: 1509-35-9
Catalog No.: 189187
Purity: 95%
MF: C6H13NO2
MW: 131.175
Storage: 2-8 degree Celsius
SMILES: N[C@@H](C(=O)O)[C@H](CC)C
Catalog No.: 189187
Purity: 95%
MF: C6H13NO2
MW: 131.175
Storage: 2-8 degree Celsius
SMILES: N[C@@H](C(=O)O)[C@H](CC)C
(2R,3S)-2-amino-3-methylpentanoic acid; CAS No.: 1509-35-9; (2R,3S)-2-amino-3-methylpentanoic acid represents the chiral amino acids category within Chem Shuttle's product range. As a leading chemicals distributor, Chem Shuttle offers access to non-proteinogenic amino acids with defined stereochemistry that are essential for the synthesis of various pharmaceuticals and agrochemicals. This compound, with its R and S configurations, is particularly valuable as a building block for the production of stereospecific drugs and bioactive peptides. Chem Shuttle's custom compound synthesis services allow for the production of such chiral amino acids to exact specifications, supporting the development of novel therapeutic agents. The company's focus on chemical blocks ensures that researchers can obtain high-purity (2R,3S)-2-amino-3-methylpentanoic acid, facilitating advancements in asymmetric synthesis and chiral drug development.
Reviews
Write Your Own Review