![3-benzyl-3,7-diazabicyclo[3.3.0]octane](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/0/101335_2.jpg)
tert-butyl 3-aminocyclohexylcarbamate
$200.00
CAS No.: 347186-01-0
Catalog No.: 101497
Purity: 95%
MF: C11H22N2O2
MW: 214.309
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1CCCC(N)C1
Catalog No.: 101497
Purity: 95%
MF: C11H22N2O2
MW: 214.309
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC1CCCC(N)C1
tert-butyl 3-aminocyclohexylcarbamate; CAS No.: 347186-01-0; tert-Butyl 3-aminocyclohexylcarbamate falls under ChemShuttle's building blocks for drug discovery. This protected amine derivative serves as a valuable intermediate in peptide and pharmaceutical synthesis. As a chemical online mall, ChemShuttle distributes this compound for diverse applications. The Boc protection allows for controlled deprotection during synthesis sequences. Researchers in pharmaceutical and materials science fields utilize it as a chemical block to construct molecules with specific properties.
Reviews
Write Your Own Review