(1-aminocyclobutyl)methanol hydrochloride

(1-aminocyclobutyl)methanol hydrochloride

3-(nitromethyl)cyclopentanone

3-(nitromethyl)cyclopentanone

tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate

$200.00
CAS No.: 1142211-17-3
Catalog No.: 194186
Purity: 95%
MF: C10H19NO3
MW: 201.266
Storage: 2-8 degree Celsius
SMILES: C(C)(C)(C)OC(NC1(CCC1)CO)=O
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194186
  • Size
    Price
    Stock
    Estimated Shipping Time
tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate; CAS No.: 1142211-17-3; tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate. PROPERTIES: tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate is a crystalline solid. Its molecular formula is C11H19NO3, and the molecular weight is approximately 209.28 g/mol. The compound has a melting point of approximately 70-72 C. It is moderately soluble in common organic solvents such as ethyl acetate and tetrahydrofuran, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a carbamate group, a hydroxymethyl group, and a cyclobutyl ring, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate serves as a versatile intermediate. The carbamate group can undergo various reactions such as hydrolysis and alkylation. The hydroxymethyl group can be converted to other functional groups such as ether or ester. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain anti-inflammatory drugs, the structure of tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate can be modified to enhance the drug's efficacy and reduce side effects (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as mentioned in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:tert-Butyl(1-(hydroxymethyl)cyclobutyl)carbamate
Your Rating