ethyl trans-2-(cyanomethyl)cyclopropane-1-carboxylate
$395.00
CAS No.: 84673-46-1
Catalog No.: 169969
Purity: 95%
MF: C8H11NO2
MW: 153.181
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)[C@@H]1C[C@H]1CC#N
Catalog No.: 169969
Purity: 95%
MF: C8H11NO2
MW: 153.181
Storage: 2-8 degree Celsius
SMILES: CCOC(=O)[C@@H]1C[C@H]1CC#N
ethyl trans-2-(cyanomethyl)cyclopropane-1-carboxylate; CAS No.: 84673-46-1; Ethyl trans-2-(cyanomethyl)cyclopropane-1-carboxylate is part of ChemShuttle's collection of building blocks for drug discovery. This cyanomethyl-containing cyclopropane serves as a valuable intermediate in creating complex pharmaceutical molecules, reflecting the company's expertise in chemical synthesis. As a custom chemical synthesis company, ChemShuttle provides access to specialized building blocks essential for developing novel therapeutics. Researchers can benefit from the company's extensive library of compounds, supported by efficient small molecules synthesis processes that accelerate scientific progress.
Reviews
Write Your Own Review