(1R,2S)-2-(3,4-difluorophenyl)cyclopropanamine (R)-2-hydroxy-2-phenylacetate
$250.00
CAS No.: 376608-71-8
Catalog No.: 101861
Purity: 95%
MF: C17H17F2NO3
MW: 321.323
Storage: 2-8 degree Celsius
SMILES: O[C@@H](C(O)=O)C1=CC=CC=C1.N[C@@H]1C[C@H]1C1=CC=C(F)C(F)=C1
Catalog No.: 101861
Purity: 95%
MF: C17H17F2NO3
MW: 321.323
Storage: 2-8 degree Celsius
SMILES: O[C@@H](C(O)=O)C1=CC=CC=C1.N[C@@H]1C[C@H]1C1=CC=C(F)C(F)=C1
(1R,2S)-2-(3,4-difluorophenyl)cyclopropanamine (R)-2-hydroxy-2-phenylacetate; CAS No.: 376608-71-8; ChemShuttle, a chemical synthesis company, provides compounds such as (1R,2S)-2-(3,4-difluorophenyl)cyclopropanamine (R)-2-hydroxy-2-phenylacetate. As a Leading Chemicals Distributor, it specializes in offering key intermediates for drug development. The company's expertise in chemical building blocks makes it a valuable resource for scientists seeking to advance their research.
Reviews
Write Your Own Review