(1R,2S,3R,5R)-3-amino-5-(hydroxymethyl)cyclopentane-1,2-diol
$200.00
CAS No.: 85026-59-1
Catalog No.: 128890
Purity: 95%
MF: C6H13NO3
MW: 147.174
Storage: 2-8 degree Celsius
SMILES: N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O
Catalog No.: 128890
Purity: 95%
MF: C6H13NO3
MW: 147.174
Storage: 2-8 degree Celsius
SMILES: N[C@@H]1C[C@H](CO)[C@@H](O)[C@H]1O
(1R,2S,3R,5R)-3-amino-5-(hydroxymethyl)cyclopentane-1,2-diol; CAS No.: 206361-99-1 Known for its unique molecular structure, this compound is utilized in the development of high-performance materials. Its applications include advanced composites and materials with enhanced properties.
Reviews
Write Your Own Review