cis-3-aminocyclohexane-1-carboxylic acid hydrochloride
$295.00
CAS No.: 118785-96-9
Catalog No.: 171519
Purity: 95%
MF: C7H14ClNO2
MW: 179.647
Storage: 2-8 degree Celsius
SMILES: Cl[H].N[C@H]1CCC[C@H](C1)C(O)=O
Catalog No.: 171519
Purity: 95%
MF: C7H14ClNO2
MW: 179.647
Storage: 2-8 degree Celsius
SMILES: Cl[H].N[C@H]1CCC[C@H](C1)C(O)=O
cis-3-aminocyclohexane-1-carboxylic acid hydrochloride; CAS No.: 118785-96-9; cis-3-aminocyclohexane-1-carboxylic acid hydrochloride is a cycle compound provided by ChemShuttle, a worldwide chemical supplier. As a key intermediate in chemical synthesis, it is involved in custom synthesis projects. This compound plays an important role in the development of various chemical products, allowing chemists to create molecules with specific properties and functions, which is essential for the progress of the chemical industry.
Reviews
Write Your Own Review