trans-tert-Butyl 3-hydroxy-2,2,4,4-(tetramethyl)cyclobutylcarbamate
$250.00
CAS No.: 1338812-41-1
Catalog No.: 185713
Purity: 95%
MF: C13H25NO3
MW: 243.347
Storage: 2-8 degree Celsius
SMILES: O[C@@H]1C([C@H](C1(C)C)NC(OC(C)(C)C)=O)(C)C
Catalog No.: 185713
Purity: 95%
MF: C13H25NO3
MW: 243.347
Storage: 2-8 degree Celsius
SMILES: O[C@@H]1C([C@H](C1(C)C)NC(OC(C)(C)C)=O)(C)C
trans-tert-Butyl 3-hydroxy-2,2,4,4-(tetramethyl)cyclobutylcarbamate; CAS No.: 500-49-2 Known for its unique molecular structure, this compound is utilized in the development of high-performance materials. Its applications include advanced composites and materials with enhanced properties.
Reviews
Write Your Own Review