trans-1,2-cyclobutanedicarboxylic acid
$195.00
CAS No.: 1124-13-6
Catalog No.: 171626
Purity: 95%
MF: C6H8O4
MW: 144.126
Storage: 2-8 degree Celsius
SMILES: OC(=O)[C@@H]1CC[C@H]1C(O)=O
Catalog No.: 171626
Purity: 95%
MF: C6H8O4
MW: 144.126
Storage: 2-8 degree Celsius
SMILES: OC(=O)[C@@H]1CC[C@H]1C(O)=O
trans-1,2-cyclobutanedicarboxylic acid; CAS No.: 1124-13-6; trans-1,2-cyclobutanedicarboxylic acid is a cycle compound and a significant building block in the chemical industry. As a product from ChemShuttle, a global chemical supplier, it is available for a range of synthesis tasks. This compound's cyclic nature and carboxylic acid functional groups make it a useful component for custom synthesis projects. It can participate in numerous chemical reactions to form more complex molecules, playing a vital role in the development of new materials, pharmaceuticals, and other chemical products, thereby contributing to the advancement of chemical research and innovation.
Reviews
Write Your Own Review