2-((tert-butoxycarbonyl)amino)-3-cyclobutylpropanoic acid
$200.00
CAS No.: 565456-75-9
Catalog No.: 170183
Purity: 95%
MF: C12H21NO4
MW: 243.303
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC(CC1CCC1)C(O)=O
Catalog No.: 170183
Purity: 95%
MF: C12H21NO4
MW: 243.303
Storage: 2-8 degree Celsius
SMILES: CC(C)(C)OC(=O)NC(CC1CCC1)C(O)=O
2-((tert-butoxycarbonyl)amino)-3-cyclobutylpropanoic acid; CAS No.: 565456-75-9; 2-((tert-butoxycarbonyl)amino)-3-cyclobutylpropanoic acid demonstrates ChemShuttle's building blocks for drug discovery. As a Leading Chemicals Distributor, we offer Boc-protected amino acid derivatives for research. This compound combines a cyclobutyl group with a protected amino acid moiety, providing unique steric properties. ChemShuttle's custom synthesis capabilities ensure precise substitution and high purity. The Boc protection allows for controlled deprotection and further conjugation, making this compound valuable in peptide synthesis and medicinal chemistry.
Reviews
Write Your Own Review