1-(4-hydroxy-5-methoxy-2-nitrophenyl)cyclobutanecarbonitrile
$350.00
CAS No.: 1527503-23-6
Catalog No.: 110820
Purity: 95%
MF: C12H12N2O4
MW: 248.238
Storage: 2-8 degree Celsius
SMILES: COC1=C(O)C=C(C(=C1)C1(CCC1)C#N)[N+]([O-])=O
Catalog No.: 110820
Purity: 95%
MF: C12H12N2O4
MW: 248.238
Storage: 2-8 degree Celsius
SMILES: COC1=C(O)C=C(C(=C1)C1(CCC1)C#N)[N+]([O-])=O
1-(4-hydroxy-5-methoxy-2-nitrophenyl)cyclobutanecarbonitrile; CAS No.: 1527503-23-6 - This building block is essential in the synthesis of heterocyclic compounds used in the pharmaceutical industry. Its downstream applications include the production of antiviral and antibacterial drugs. The compound's high reactivity and compatibility with various chemical reactions are key benefits, facilitating its use in drug development.
Reviews
Write Your Own Review