cis-cyclohexane-1,4-dicarboxylic acid
$350.00
CAS No.: 619-81-8
Catalog No.: 189192
Purity: 95%
MF: C8H12O4
MW: 172.18
Storage: 2-8 degree Celsius
SMILES: O=C([C@H]1CC[C@@H](C(O)=O)CC1)O
Catalog No.: 189192
Purity: 95%
MF: C8H12O4
MW: 172.18
Storage: 2-8 degree Celsius
SMILES: O=C([C@H]1CC[C@@H](C(O)=O)CC1)O
cis-cyclohexane-1,4-dicarboxylic acid; CAS No.: 619-81-8; cis-cyclohexane-1,4-dicarboxylic acid is one of the many polycarboxylic acids available through Chem Shuttle's extensive product offerings. As a leading chemicals distributor, Chem Shuttle offers access to cyclic dicarboxylic acids that are essential for the synthesis of various pharmaceuticals, polymers, and agrochemicals. This compound, with its cis configuration, serves as a valuable building block for the production of stereo-specific materials and bioactive molecules. Chem Shuttle's custom chemical synthesis services allow for the production of such specialized acids to exact specifications, supporting the development of novel therapeutic agents and advanced materials. The company's focus on chemical blocks ensures that researchers can obtain high-purity cis-cyclohexane-1,4-dicarboxylic acid, facilitating advancements in medicinal chemistry and organic synthesis.
Reviews
Write Your Own Review