![3-fluorobicyclo[1.1.1]pentane-1-carboxylic acid](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/5/158770_2.jpg)
![tert-butyl (3-cyanobicyclo[1.1.1]pentan-1-yl)carbamate](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/184580_1.jpg)
1,3-dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate
$245.00
CAS No.: 115913-32-1
Catalog No.: 171585
Purity: 95%
MF: C9H12O4
MW: 184.191
Storage: 2-8 degree Celsius
SMILES: COC(=O)C12CC(C1)(C2)C(=O)OC
Catalog No.: 171585
Purity: 95%
MF: C9H12O4
MW: 184.191
Storage: 2-8 degree Celsius
SMILES: COC(=O)C12CC(C1)(C2)C(=O)OC
1,3-dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate; CAS No.: 115913-32-1; 1,3-dimethyl bicyclo[1.1.1]pentane-1,3-dicarboxylate is a chem block from ChemShuttle, a worldwide chemical supplier. As a building block for drug discovery, it participates in CRO chemical synthesis. The bicyclic structure with the ester groups offers multiple sites for chemical modifications. Chemists can use it to build more complex molecules by reacting the ester groups, which can lead to the development of new drug candidates or other bioactive compounds. Its unique structure provides a foundation for innovative chemical synthesis.
Reviews
Write Your Own Review