![2,6-diazaspiro[3.3]heptane dihydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/189118_2.jpg)
![1-oxaspiro[3.5]nonan-7-one](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/8/189094_2.jpg)
(1s,4s)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid
$350.00
CAS No.: 1202578-27-5
Catalog No.: 189106
Purity: 95%
MF: C8H11F3O2
MW: 196.168
Storage: 2-8 degree Celsius
SMILES: O=C([C@H]1CC[C@@H](C(F)(F)F)CC1)O
Catalog No.: 189106
Purity: 95%
MF: C8H11F3O2
MW: 196.168
Storage: 2-8 degree Celsius
SMILES: O=C([C@H]1CC[C@@H](C(F)(F)F)CC1)O
(1s,4s)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid; CAS No.: 1202578-27-5; (1s,4s)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid is part of Chem Shuttle's collection of fluorinated carboxylic acids that serve as key intermediates in drug discovery. As a custom chemical synthesis company, Chem Shuttle specializes in producing cyclohexane derivatives with trifluoromethyl groups that are crucial for the development of various pharmaceuticals and agrochemicals with enhanced biological activities. This compound, with its trifluoromethyl substituent and defined stereochemistry, is particularly valuable as a building block for the production of stereospecific drugs and materials. Chem Shuttle's online chemical store offers researchers convenient access to such specialized chemicals, supporting their work in medicinal chemistry and organic synthesis. The company's expertise in process chemistry ensures that (1s,4s)-4-(trifluoromethyl)cyclohexane-1-carboxylic acid is produced efficiently and to high purity standards, making it a reliable component in various synthetic pathways.
Reviews
Write Your Own Review