![endo-7-azabicyclo[2.2.1]heptan-2-ol hydrochloride](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/190207_2.jpg)
![5-oxa-8-azaspiro[3.5]nonane](https://www.chemshuttle.com/media/catalog/product/cache/31dbf0bffbfa69a5826a72cec9a446de/1/9/190203_2.jpg)
1,1-dimethylethyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate hydrochloride
$450.00
CAS No.: 2231674-95-4
Catalog No.: 190206
Purity: 95%
MF: C10H19ClN2O2
MW: 234.727
Storage: 2-8 degree Celsius
SMILES: Cl.C12N(CCNC2C1)C(=O)OC(C)(C)C
Catalog No.: 190206
Purity: 95%
MF: C10H19ClN2O2
MW: 234.727
Storage: 2-8 degree Celsius
SMILES: Cl.C12N(CCNC2C1)C(=O)OC(C)(C)C
1,1-dimethylethyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate hydrochloride; CAS No.: 2231674-95-4; 1,1-dimethylethyl 2,5-diazabicyclo[4.1.0]heptane-2-carboxylate hydrochloride exemplifies ChemShuttle's extensive library of pharma building blocks. As a custom chemical synthesis company, ChemShuttle offers CRO chemical synthesis services that cater to the specific needs of drug development pipelines. This bicyclic compound, protected as a hydrochloride salt, is particularly valuable in the construction of complex drug molecules. The company's status as a worldwide chemical supplier ensures timely delivery and consistent quality, making it an indispensable partner for laboratories engaged in medicinal chemistry research. ChemShuttle's focus on providing essential intermediates supports the advancement of therapeutic discovery across multiple disease areas.
Reviews
Write Your Own Review