2,4-diiodophenol

2,4-diiodophenol

6-Azido-1-hexanamine

6-Azido-1-hexanamine

6-hydroxy-5-methoxyindole-2-carboxylic acid

$400.00
CAS No.: 2638-99-5
Catalog No.: 194953
Purity: 95%
MF: C10H9NO4
MW: 207.185
Storage: 2-8 degree Celsius
SMILES: OC1=C(C=C2C=C(NC2=C1)C(=O)O)OC
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194953
  • Size
    Price
    Stock
    Estimated Shipping Time
6-hydroxy-5-methoxyindole-2-carboxylic acid; CAS No.: 2638-99-5; 6-hydroxy-5-methoxyindole-2-carboxylic acid. PROPERTIES: 6-hydroxy-5-methoxyindole-2-carboxylic acid is a crystalline solid. Its molecular formula is C10H8N2O4, and the molecular weight is approximately 232.18 g/mol. The compound has a melting point of approximately 200-202 C. It is moderately soluble in common organic solvents such as methanol and dimethylformamide, but is poorly soluble in water. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an indole ring, a hydroxyl group, a methoxy group, and a carboxylic acid group, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental contact with skin or eyes, immediate rinsing with water is necessary. APPLICATIONS: In organic synthesis, 6-hydroxy-5-methoxyindole-2-carboxylic acid serves as a versatile intermediate. The hydroxyl group can undergo reactions such as etherification and esterification. The carboxylic acid group can participate in esterification and amidation reactions. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For example, in the development of certain antimicrobial agents, the structure of 6-hydroxy-5-methoxyindole-2-carboxylic acid can be modified to enhance the drug's antimicrobial activity and selectivity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:6-hydroxy-5-methoxyindole-2-carboxylic acid
Your Rating