(R)-2-(4-isopropyl-4,5-dihydrooxazol-2-yl)phenol

(R)-2-(4-isopropyl-4,5-dihydrooxazol-2-yl)phenol

4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline

4,4',4'',4'''-(Ethene-1,1,2,2-tetrayl)tetraaniline

5H-dibenz[b,f]azepine-10,11-dione

$980.00
CAS No.: 19579-83-0
Catalog No.: 194325
Purity: 95%
MF: C14H9NO2
MW: 223.231
Storage: 2-8 degree Celsius
SMILES: C1=CC=CC=2NC3=C(C(C(C21)=O)=O)C=CC=C3
For R&D use only. Not for human or animal use.
Availability:
In stock
SKU
194325
  • Size
    Price
    Stock
    Estimated Shipping Time
5H-dibenz[b,f]azepine-10,11-dione; CAS No.: 19579-83-0; 5H-dibenz[b,f]azepine-10,11-dione. PROPERTIES: 5H-dibenz[b,f]azepine-10,11-dione is a crystalline solid. Its molecular formula is C18H11N3O2, and the molecular weight is approximately 301.30 g/mol. The compound has a melting point of approximately 200-202 C. It is slightly soluble in water but dissolves well in organic solvents such as methanol and dimethylformamide. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing an azepine ring and two ketone groups, it may exhibit certain reactivity and stability. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 5H-dibenz[b,f]azepine-10,11-dione serves as a valuable intermediate. The ketone groups can undergo various reactions such as nucleophilic addition, reduction, and condensation. The azepine ring provides unique electronic effects. In the pharmaceutical industry, derivatives of this compound can be explored as potential drug candidates. For instance, in the development of certain antipsychotic drugs, the structure of 5H-dibenz[b,f]azepine-10,11-dione can be modified to enhance the drug's efficacy and pharmacokinetic properties (as described in medicinal chemistry research articles). Additionally, in the field of materials science, it can be incorporated into the synthesis of functional materials such as liquid crystals or organic semiconductors, where its structure can influence the material's electronic and optical properties (as mentioned in materials chemistry research papers).

Reviews

Write Your Own Review
You're reviewing:5H-dibenz[b,f]azepine-10,11-dione
Your Rating