5-methyl-2-nitrobenzyl alcohol
$250.00
CAS No.: 66424-92-8
Catalog No.: 194099
Purity: 95%
MF: C8H9NO3
MW: 167.164
Storage: 2-8 degree Celsius
SMILES: CC=1C=CC(=C(CO)C1)[N+](=O)[O-]
Catalog No.: 194099
Purity: 95%
MF: C8H9NO3
MW: 167.164
Storage: 2-8 degree Celsius
SMILES: CC=1C=CC(=C(CO)C1)[N+](=O)[O-]
5-methyl-2-nitrobenzyl alcohol; CAS No.: 66424-92-8; 5-methyl-2-nitrobenzyl alcohol. PROPERTIES: 5-methyl-2-nitrobenzyl alcohol is a crystalline solid. Its molecular formula is C8H9NO3, and the molecular weight is approximately 167.16 g/mol. The compound has a melting point of approximately 50-52 C. It is slightly soluble in water but dissolves well in organic solvents such as ethanol and acetone. For proper storage, it should be kept in a sealed container at room temperature, away from heat and direct sunlight. As a compound containing a nitro group and an alcohol group, it may exhibit certain acidity and reactivity. When handling it, protective gloves and eye protection should be worn. In case of accidental ingestion, medical attention should be sought immediately. APPLICATIONS: In organic synthesis, 5-methyl-2-nitrobenzyl alcohol serves as a versatile intermediate. The alcohol group can undergo reactions such as esterification, oxidation, and formation of ethers. The nitro group can be reduced to an amine group. The methyl group provides steric effects. In the pharmaceutical industry, derivatives of 5-methyl-2-nitrobenzyl alcohol can be explored as potential drug candidates. For instance, in the development of certain antimicrobial agents, the unique structure of this compound can be utilized to design drugs with enhanced antimicrobial activity (as reported in medicinal chemistry journals). Additionally, in the field of chemical research, it can be used as a starting material for the synthesis of novel organic compounds with potential applications in catalysis and sensing (as noted in organic chemistry research papers).
Reviews
Write Your Own Review